CAS 15989-99-8 is the registry number for 2,3,4,5,6-Pentafluorobenzoic anhydride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
(2,3,4,5,6-pentafluorobenzoyl) 2,3,4,5,6-pentafluorobenzoate (CAS 15989-99-8) is a chemical compound with the molecular formula C14F10O3 and a molecular weight of 406.13 g/mol. IUPAC name: (2,3,4,5,6-pentafluorobenzoyl) 2,3,4,5,6-pentafluorobenzoate. InChIKey: BGCIWPHADHBSOS-UHFFFAOYSA-N.
| Molecular formula | C14F10O3 |
|---|---|
| Molecular weight | 406.13 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorobenzoyl) 2,3,4,5,6-pentafluorobenzoate |
| InChIKey | BGCIWPHADHBSOS-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)C(=O)OC(=O)C2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)