CAS 159896-31-8 appears in our catalog under these names: 3'-(Pentafluorosulfur)acetophenone, 95%, 3'-(Pentafluorosulfur)acetophenone, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
1-[3-(pentafluoro-lambda6-sulfanyl)phenyl]ethanone (CAS 159896-31-8) is a chemical compound with the molecular formula C8H7F5OS and a molecular weight of 246.20 g/mol. IUPAC name: 1-[3-(pentafluoro-lambda6-sulfanyl)phenyl]ethanone. InChIKey: GUYKQTMZBIAURU-UHFFFAOYSA-N.
| Molecular formula | C8H7F5OS |
|---|---|
| Molecular weight | 246.20 g/mol |
| IUPAC name | 1-[3-(pentafluoro-lambda6-sulfanyl)phenyl]ethanone |
| InChIKey | GUYKQTMZBIAURU-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)S(F)(F)(F)(F)F |
Computed by PubChem (NCBI)