CAS 1599-41-3 is the registry number for 1,2,2-Trichloropentafluoropropane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
1,2,2-trichloro-1,1,3,3,3-pentafluoropropane (CAS 1599-41-3) is a chemical compound with the molecular formula C3Cl3F5 and a molecular weight of 237.38 g/mol. IUPAC name: 1,2,2-trichloro-1,1,3,3,3-pentafluoropropane. InChIKey: SFCFZNZZFJRHSD-UHFFFAOYSA-N.
| Molecular formula | C3Cl3F5 |
|---|---|
| Molecular weight | 237.38 g/mol |
| IUPAC name | 1,2,2-trichloro-1,1,3,3,3-pentafluoropropane |
| InChIKey | SFCFZNZZFJRHSD-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)(C(F)(F)Cl)(Cl)Cl |
Computed by PubChem (NCBI)