Products 1599210-06-6
CAS 1599210-06-6 is the registry number for 1-(Difluoromethyl)-5-methoxy-1H-indole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(difluoromethyl)-5-methoxyindole (CAS 1599210-06-6) is a chemical compound with the molecular formula C10H9F2NO and a molecular weight of 197.18 g/mol. IUPAC name: 1-(difluoromethyl)-5-methoxyindole. InChIKey: VTXQFUPANDKPJP-UHFFFAOYSA-N.
| Molecular formula | C10H9F2NO |
|---|---|
| Molecular weight | 197.18 g/mol |
| IUPAC name | 1-(difluoromethyl)-5-methoxyindole |
| InChIKey | VTXQFUPANDKPJP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N(C=C2)C(F)F |
Computed by PubChem (NCBI)