CAS 1599370-38-3 is the registry number for 2-Bromo-N-(2,5-dibromophenyl)-2-methylpropanamide, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
2-bromo-N-(2,5-dibromophenyl)-2-methylpropanamide (CAS 1599370-38-3) is a chemical compound with the molecular formula C10H10Br3NO and a molecular weight of 399.90 g/mol. IUPAC name: 2-bromo-N-(2,5-dibromophenyl)-2-methylpropanamide. InChIKey: KJLNWPIWHOAORO-UHFFFAOYSA-N.
| Molecular formula | C10H10Br3NO |
|---|---|
| Molecular weight | 399.90 g/mol |
| IUPAC name | 2-bromo-N-(2,5-dibromophenyl)-2-methylpropanamide |
| InChIKey | KJLNWPIWHOAORO-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)NC1=C(C=CC(=C1)Br)Br)Br |
Computed by PubChem (NCBI)