CAS 159945-02-5 is the registry number for Methyl 2-deoxy-2- (trifluoromethyl)-a-D-arabinofuranoside-diacetate. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg.
[(2R,3S,4S,5S)-3-acetyloxy-5-methoxy-4-(trifluoromethyl)oxolan-2-yl]methyl acetate (CAS 159945-02-5) is a chemical compound with the molecular formula C11H15F3O6 and a molecular weight of 300.23 g/mol. IUPAC name: [(2R,3S,4S,5S)-3-acetyloxy-5-methoxy-4-(trifluoromethyl)oxolan-2-yl]methyl acetate. InChIKey: FLMUHDLCWYXXHC-RGOKHQFPSA-N.
| Molecular formula | C11H15F3O6 |
|---|---|
| Molecular weight | 300.23 g/mol |
| IUPAC name | [(2R,3S,4S,5S)-3-acetyloxy-5-methoxy-4-(trifluoromethyl)oxolan-2-yl]methyl acetate |
| InChIKey | FLMUHDLCWYXXHC-RGOKHQFPSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H](O1)OC)C(F)(F)F)OC(=O)C |
Computed by PubChem (NCBI)