Products 1599486-33-5
CAS 1599486-33-5 appears in our catalog under these names: Mal-peg6-pfp, 95%, Mal-PEG6-PFP ester, 95%, Mal–PEG6–PFP ester, Mal-PEG6-PFP ester, Mal-PEG6-PFP. Offered by: Combi-blocks, AmBeed, GLPBio, TargetMol, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg, 2mg, 25 mg, 50 mg.
(2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1599486-33-5) is a chemical compound with the molecular formula C25H30F5NO10 and a molecular weight of 599.5 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: HDNANNZNASDAGQ-UHFFFAOYSA-N.
| Molecular formula | C25H30F5NO10 |
|---|---|
| Molecular weight | 599.5 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | HDNANNZNASDAGQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCCOCCOCCOCCOCCC(=O)OC2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)