CAS 1599524-58-9 is the registry number for 6-Bromo-2,4-dichloro-3-phenoxyquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-2,4-dichloro-3-phenoxyquinoline (CAS 1599524-58-9) is a chemical compound with the molecular formula C15H8BrCl2NO and a molecular weight of 369.0 g/mol. IUPAC name: 6-bromo-2,4-dichloro-3-phenoxyquinoline. InChIKey: VSHXWURSGLRTBO-UHFFFAOYSA-N.
| Molecular formula | C15H8BrCl2NO |
|---|---|
| Molecular weight | 369.0 g/mol |
| IUPAC name | 6-bromo-2,4-dichloro-3-phenoxyquinoline |
| InChIKey | VSHXWURSGLRTBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C3=C(C=CC(=C3)Br)N=C2Cl)Cl |
Computed by PubChem (NCBI)