CAS 159979-96-1 is the registry number for 1-(Azidomethyl)-4-fluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
1-(azidomethyl)-4-fluorobenzene (CAS 159979-96-1) is a chemical compound with the molecular formula C7H6FN3 and a molecular weight of 151.14 g/mol. IUPAC name: 1-(azidomethyl)-4-fluorobenzene. InChIKey: UEQMFQIPTDUPPJ-UHFFFAOYSA-N.
| Molecular formula | C7H6FN3 |
|---|---|
| Molecular weight | 151.14 g/mol |
| IUPAC name | 1-(azidomethyl)-4-fluorobenzene |
| InChIKey | UEQMFQIPTDUPPJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN=[N+]=[N-])F |
Computed by PubChem (NCBI)