CAS 160001-85-4 is the registry number for 4-tert-Butylbenzotrifluoride, 98%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g.
1-tert-butyl-4-(trifluoromethyl)benzene (CAS 160001-85-4) is a chemical compound with the molecular formula C11H13F3 and a molecular weight of 202.22 g/mol. IUPAC name: 1-tert-butyl-4-(trifluoromethyl)benzene. InChIKey: AAHQWGQDFWPRNY-UHFFFAOYSA-N.
| Molecular formula | C11H13F3 |
|---|---|
| Molecular weight | 202.22 g/mol |
| IUPAC name | 1-tert-butyl-4-(trifluoromethyl)benzene |
| InChIKey | AAHQWGQDFWPRNY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)