Products 160009-35-8

CAS 160009-35-8 is the registry number for Rosuvastatin Impurity 119. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 4-(4-fluorophenyl)-2-methylsulfanyl-6-propan-2-ylpyrimidine-5-carboxylate (CAS 160009-35-8) is a chemical compound with the molecular formula C16H17FN2O2S and a molecular weight of 320.4 g/mol. IUPAC name: methyl 4-(4-fluorophenyl)-2-methylsulfanyl-6-propan-2-ylpyrimidine-5-carboxylate. InChIKey: ZOHVECQKEABYPF-UHFFFAOYSA-N.

Identity
Molecular formulaC16H17FN2O2S
Molecular weight320.4 g/mol
IUPAC namemethyl 4-(4-fluorophenyl)-2-methylsulfanyl-6-propan-2-ylpyrimidine-5-carboxylate
InChIKeyZOHVECQKEABYPF-UHFFFAOYSA-N
SMILESCC(C)C1=NC(=NC(=C1C(=O)OC)C2=CC=C(C=C2)F)SC

Computed by PubChem (NCBI)