CAS 160009-36-9 appears in our catalog under these names: Rosuvastatin Impurity 41, Rosuvastatin Impurity 121, Methyl 4-(4-Fluorophenyl)-6-isopropyl-2-(methylamino)pyrimidine-5-carboxylate, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg, 5mg.
Methyl 4-(4-fluorophenyl)-2-(methylamino)-6-propan-2-ylpyrimidine-5-carboxylate (CAS 160009-36-9) is a chemical compound with the molecular formula C16H18FN3O2 and a molecular weight of 303.33 g/mol. IUPAC name: methyl 4-(4-fluorophenyl)-2-(methylamino)-6-propan-2-ylpyrimidine-5-carboxylate. InChIKey: ZMUMVOISTUCVJK-UHFFFAOYSA-N.
| Molecular formula | C16H18FN3O2 |
|---|---|
| Molecular weight | 303.33 g/mol |
| IUPAC name | methyl 4-(4-fluorophenyl)-2-(methylamino)-6-propan-2-ylpyrimidine-5-carboxylate |
| InChIKey | ZMUMVOISTUCVJK-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=NC(=C1C(=O)OC)C2=CC=C(C=C2)F)NC |
Computed by PubChem (NCBI)