Products 1600462-38-1
CAS 1600462-38-1 is the registry number for 3-Bromo-5-(4-methoxyphenyl)-1,2,4-thiadiazole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-5-(4-methoxyphenyl)-1,2,4-thiadiazole (CAS 1600462-38-1) is a chemical compound with the molecular formula C9H7BrN2OS and a molecular weight of 271.14 g/mol. IUPAC name: 3-bromo-5-(4-methoxyphenyl)-1,2,4-thiadiazole. InChIKey: JRXCJWGBYHSRLY-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2OS |
|---|---|
| Molecular weight | 271.14 g/mol |
| IUPAC name | 3-bromo-5-(4-methoxyphenyl)-1,2,4-thiadiazole |
| InChIKey | JRXCJWGBYHSRLY-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC(=NS2)Br |
Computed by PubChem (NCBI)