CAS 16005-38-2 is the registry number for 2-Iodotetrafluoroethyl heptafluoroisopropyl ether, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane (CAS 16005-38-2) is a chemical compound with the molecular formula C5F11IO and a molecular weight of 411.94 g/mol. IUPAC name: 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane. InChIKey: ZTRORDXSFFFPOW-UHFFFAOYSA-N.
| Molecular formula | C5F11IO |
|---|---|
| Molecular weight | 411.94 g/mol |
| IUPAC name | 1,1,1,2,3,3,3-heptafluoro-2-(1,1,2,2-tetrafluoro-2-iodoethoxy)propane |
| InChIKey | ZTRORDXSFFFPOW-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)(C(F)(F)F)(OC(C(F)(F)I)(F)F)F |
Computed by PubChem (NCBI)