CAS 160072-56-0 appears in our catalog under these names: 4-Phenyl-1H-imidazol-2-amine hemisulfate, 97%, 4–Phenyl–1H–imidazol–2–amine hemisulfate. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 5g.
Bis(5-phenyl-1H-imidazol-2-amine);sulfuric acid (CAS 160072-56-0) is a chemical compound with the molecular formula C18H20N6O4S and a molecular weight of 416.5 g/mol. IUPAC name: bis(5-phenyl-1H-imidazol-2-amine);sulfuric acid. InChIKey: QUOBUFFJHIDCPX-UHFFFAOYSA-N.
| Molecular formula | C18H20N6O4S |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | bis(5-phenyl-1H-imidazol-2-amine);sulfuric acid |
| InChIKey | QUOBUFFJHIDCPX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(N2)N.C1=CC=C(C=C1)C2=CN=C(N2)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)