CAS 16009-13-5 appears in our catalog under these names: Hemin(chloride), min. 95 %, 5 g, glass, Hemin Chloride (Technical grade), Hemin chloride, Hemin/ 99.59% (existing batch purity), Hemin (porcine), 97+% . Offered by: Roth, TRC, GLPBio, TargetMol, Thermo Scientific (Alfa Aesar). Available pack sizes: 5g, 10g, 1g, 25g, 0,025kg, 0,01kg, 0,05kg, 50g.
3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoic acid;iron(3+);chloride (CAS 16009-13-5) is a chemical compound with the molecular formula C34H32ClFeN4O4 and a molecular weight of 651.9 g/mol. IUPAC name: 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoic acid;iron(3+);chloride. InChIKey: BTIJJDXEELBZFS-UHFFFAOYSA-K.
| Molecular formula | C34H32ClFeN4O4 |
|---|---|
| Molecular weight | 651.9 g/mol |
| IUPAC name | 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoic acid;iron(3+);chloride |
| InChIKey | BTIJJDXEELBZFS-UHFFFAOYSA-K |
| SMILES | CC1=C(C2=CC3=C(C(=C([N-]3)C=C4C(=C(C(=N4)C=C5C(=C(C(=N5)C=C1[N-]2)C)C=C)C)C=C)C)CCC(=O)O)CCC(=O)O.[Cl-].[Fe+3] |
Computed by PubChem (NCBI)