CAS 1601096-45-0 is the registry number for 5-Bromo-N-ethyl-4-fluoro-2-nitroaniline, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 25g.
5-bromo-N-ethyl-4-fluoro-2-nitroaniline (CAS 1601096-45-0) is a chemical compound with the molecular formula C8H8BrFN2O2 and a molecular weight of 263.06 g/mol. IUPAC name: 5-bromo-N-ethyl-4-fluoro-2-nitroaniline. InChIKey: QEPZIFUPPFODIW-UHFFFAOYSA-N.
| Molecular formula | C8H8BrFN2O2 |
|---|---|
| Molecular weight | 263.06 g/mol |
| IUPAC name | 5-bromo-N-ethyl-4-fluoro-2-nitroaniline |
| InChIKey | QEPZIFUPPFODIW-UHFFFAOYSA-N |
| SMILES | CCNC1=CC(=C(C=C1[N+](=O)[O-])F)Br |
Computed by PubChem (NCBI)