Products 16014-23-6

CAS 16014-23-6 is the registry number for Vulcafix Rubine V. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-hydroxy-4-[(4-methyl-2-sulfophenyl)diazenyl]naphthalene-2-carboxylic acid (CAS 16014-23-6) is a chemical compound with the molecular formula C18H14N2O6S and a molecular weight of 386.4 g/mol. IUPAC name: 3-hydroxy-4-[(4-methyl-2-sulfophenyl)diazenyl]naphthalene-2-carboxylic acid. InChIKey: JYNBEDVXQNFTOX-UHFFFAOYSA-N.

Identity
Molecular formulaC18H14N2O6S
Molecular weight386.4 g/mol
IUPAC name3-hydroxy-4-[(4-methyl-2-sulfophenyl)diazenyl]naphthalene-2-carboxylic acid
InChIKeyJYNBEDVXQNFTOX-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)N=NC2=C(C(=CC3=CC=CC=C32)C(=O)O)O)S(=O)(=O)O

Computed by PubChem (NCBI)