CAS 16014-23-6 is the registry number for Vulcafix Rubine V. Offered by: Chemat Brand. Available pack sizes: on request.
3-hydroxy-4-[(4-methyl-2-sulfophenyl)diazenyl]naphthalene-2-carboxylic acid (CAS 16014-23-6) is a chemical compound with the molecular formula C18H14N2O6S and a molecular weight of 386.4 g/mol. IUPAC name: 3-hydroxy-4-[(4-methyl-2-sulfophenyl)diazenyl]naphthalene-2-carboxylic acid. InChIKey: JYNBEDVXQNFTOX-UHFFFAOYSA-N.
| Molecular formula | C18H14N2O6S |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 3-hydroxy-4-[(4-methyl-2-sulfophenyl)diazenyl]naphthalene-2-carboxylic acid |
| InChIKey | JYNBEDVXQNFTOX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N=NC2=C(C(=CC3=CC=CC=C32)C(=O)O)O)S(=O)(=O)O |
Computed by PubChem (NCBI)