CAS 1601461-44-2 is the registry number for (S)-tert-Butyl 3-(aminomethyl)-3-fluoropyrrolidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl (3S)-3-(aminomethyl)-3-fluoropyrrolidine-1-carboxylate (CAS 1601461-44-2) is a chemical compound with the molecular formula C10H19FN2O2 and a molecular weight of 218.27 g/mol. IUPAC name: tert-butyl (3S)-3-(aminomethyl)-3-fluoropyrrolidine-1-carboxylate. InChIKey: AIGHVUMGNOAZIB-JTQLQIEISA-N.
| Molecular formula | C10H19FN2O2 |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | tert-butyl (3S)-3-(aminomethyl)-3-fluoropyrrolidine-1-carboxylate |
| InChIKey | AIGHVUMGNOAZIB-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@](C1)(CN)F |
Computed by PubChem (NCBI)