CAS 160177-67-3 appears in our catalog under these names: N-((3-endo)-9-Azabicyclo[3.3.1]nonan-3-yl)-1-methyl-1H-indazole-3-carboxamide (Granisetron Impurity), 97%, N-((1R,3r,5S)-9-Azabicyclo(3.3.1)non-3-yl)-1-methyl-1H-indazole-3-carboxamide, Granisetron USP related compound C, Granisetron EP Impurity C, 9’-Desmethyl Granisetron, >95% (HPLC). Offered by: Fluorochem, Mikromol, Chemat Brand, TRC, Biosynth. Available pack sizes: 5mg, 50mg, on request, 10mg, 25mg.
N-(9-azabicyclo[3.3.1]nonan-3-yl)-1-methylindazole-3-carboxamide (CAS 160177-67-3) is a chemical compound with the molecular formula C17H22N4O and a molecular weight of 298.4 g/mol. IUPAC name: N-(9-azabicyclo[3.3.1]nonan-3-yl)-1-methylindazole-3-carboxamide. InChIKey: VIGVTDRZHFWDBM-UHFFFAOYSA-N.
| Molecular formula | C17H22N4O |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | N-(9-azabicyclo[3.3.1]nonan-3-yl)-1-methylindazole-3-carboxamide |
| InChIKey | VIGVTDRZHFWDBM-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=N1)C(=O)NC3CC4CCCC(C3)N4 |
Computed by PubChem (NCBI)