CAS 16018-49-8 is the registry number for N-(4,6-Dimethylpyrimidin-2-yl)-n'-phenylguanidine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(4,6-dimethylpyrimidin-2-yl)-1-phenylguanidine (CAS 16018-49-8) is a chemical compound with the molecular formula C13H15N5 and a molecular weight of 241.29 g/mol. IUPAC name: 2-(4,6-dimethylpyrimidin-2-yl)-1-phenylguanidine. InChIKey: VPUNGERWGVXPEK-UHFFFAOYSA-N.
| Molecular formula | C13H15N5 |
|---|---|
| Molecular weight | 241.29 g/mol |
| IUPAC name | 2-(4,6-dimethylpyrimidin-2-yl)-1-phenylguanidine |
| InChIKey | VPUNGERWGVXPEK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N=C(N)NC2=CC=CC=C2)C |
Computed by PubChem (NCBI)