Products 1601944-46-0
CAS 1601944-46-0 is the registry number for 2,6-Dichloro-8-fluoroquinoline-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-dichloro-8-fluoroquinoline-3-carboxylic acid (CAS 1601944-46-0) is a chemical compound with the molecular formula C10H4Cl2FNO2 and a molecular weight of 260.04 g/mol. IUPAC name: 2,6-dichloro-8-fluoroquinoline-3-carboxylic acid. InChIKey: UQAFAFHFXOCWDR-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl2FNO2 |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | 2,6-dichloro-8-fluoroquinoline-3-carboxylic acid |
| InChIKey | UQAFAFHFXOCWDR-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(C(=NC2=C(C=C1Cl)F)Cl)C(=O)O |
Computed by PubChem (NCBI)