CAS 160199-05-3 appears in our catalog under these names: 2,4-Dichlorobenzo[4,5]thieno[3,2-d]pyrimidine, 95%, 95%, 2,4-Dichlorobenzo[4,5]thieno[3,2-d]pyrimidine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g.
2,4-dichloro-[1]benzothiolo[3,2-d]pyrimidine (CAS 160199-05-3) is a chemical compound with the molecular formula C10H4Cl2N2S and a molecular weight of 255.12 g/mol. IUPAC name: 2,4-dichloro-[1]benzothiolo[3,2-d]pyrimidine. InChIKey: BSWVSKQCYPFXJF-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl2N2S |
|---|---|
| Molecular weight | 255.12 g/mol |
| IUPAC name | 2,4-dichloro-[1]benzothiolo[3,2-d]pyrimidine |
| InChIKey | BSWVSKQCYPFXJF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2)C(=NC(=N3)Cl)Cl |
Computed by PubChem (NCBI)