CAS 1602008-97-8 is the registry number for 4-Chloromethanesulfonyl-2,2-dimethylthiomorpholine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(chloromethylsulfonyl)-2,2-dimethylthiomorpholine (CAS 1602008-97-8) is a chemical compound with the molecular formula C7H14ClNO2S2 and a molecular weight of 243.8 g/mol. IUPAC name: 4-(chloromethylsulfonyl)-2,2-dimethylthiomorpholine. InChIKey: PAWLDLVWJFJTAZ-UHFFFAOYSA-N.
| Molecular formula | C7H14ClNO2S2 |
|---|---|
| Molecular weight | 243.8 g/mol |
| IUPAC name | 4-(chloromethylsulfonyl)-2,2-dimethylthiomorpholine |
| InChIKey | PAWLDLVWJFJTAZ-UHFFFAOYSA-N |
| SMILES | CC1(CN(CCS1)S(=O)(=O)CCl)C |
Computed by PubChem (NCBI)