CAS 160233-26-1 is the registry number for 3-Acetamido-4-fluorobenzene-1-sulfonyl chloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
3-acetamido-4-fluorobenzenesulfonyl chloride (CAS 160233-26-1) is a chemical compound with the molecular formula C8H7ClFNO3S and a molecular weight of 251.66 g/mol. IUPAC name: 3-acetamido-4-fluorobenzenesulfonyl chloride. InChIKey: QYHTYCODTAPJMY-UHFFFAOYSA-N.
| Molecular formula | C8H7ClFNO3S |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | 3-acetamido-4-fluorobenzenesulfonyl chloride |
| InChIKey | QYHTYCODTAPJMY-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=C1)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)