Products 160233-26-1

CAS 160233-26-1 is the registry number for 3-Acetamido-4-fluorobenzene-1-sulfonyl chloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

3-acetamido-4-fluorobenzenesulfonyl chloride (CAS 160233-26-1) is a chemical compound with the molecular formula C8H7ClFNO3S and a molecular weight of 251.66 g/mol. IUPAC name: 3-acetamido-4-fluorobenzenesulfonyl chloride. InChIKey: QYHTYCODTAPJMY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClFNO3S
Molecular weight251.66 g/mol
IUPAC name3-acetamido-4-fluorobenzenesulfonyl chloride
InChIKeyQYHTYCODTAPJMY-UHFFFAOYSA-N
SMILESCC(=O)NC1=C(C=CC(=C1)S(=O)(=O)Cl)F

Computed by PubChem (NCBI)