CAS 160248-96-4 appears in our catalog under these names: 2,4,6-Tris(perfluorophenyl)-1,3,5-triazine, 96%, 2,4,6-tris(perfluorophenyl)-1,3,5-triazine, 97%, Tris(pentafluorophenyl)-1,3,5-triazine. Offered by: Fluorochem, AmBeed, TRC. Available pack sizes: 100mg, 250mg, 1g, 750mg.
2,4,6-tris(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazine (CAS 160248-96-4) is a chemical compound with the molecular formula C21F15N3 and a molecular weight of 579.2 g/mol. IUPAC name: 2,4,6-tris(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazine. InChIKey: SIXHTOROHGVBMP-UHFFFAOYSA-N.
| Molecular formula | C21F15N3 |
|---|---|
| Molecular weight | 579.2 g/mol |
| IUPAC name | 2,4,6-tris(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazine |
| InChIKey | SIXHTOROHGVBMP-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)C2=NC(=NC(=N2)C3=C(C(=C(C(=C3F)F)F)F)F)C4=C(C(=C(C(=C4F)F)F)F)F |
Computed by PubChem (NCBI)