Products 1602567-15-6

CAS 1602567-15-6 is the registry number for 2-Bromoprop-2-ene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

2-bromoprop-2-ene-1-sulfonyl chloride (CAS 1602567-15-6) is a chemical compound with the molecular formula C3H4BrClO2S and a molecular weight of 219.49 g/mol. IUPAC name: 2-bromoprop-2-ene-1-sulfonyl chloride. InChIKey: LSIJHWYFTOZAJD-UHFFFAOYSA-N.

Identity
Molecular formulaC3H4BrClO2S
Molecular weight219.49 g/mol
IUPAC name2-bromoprop-2-ene-1-sulfonyl chloride
InChIKeyLSIJHWYFTOZAJD-UHFFFAOYSA-N
SMILESC=C(CS(=O)(=O)Cl)Br

Computed by PubChem (NCBI)