CAS 1602614-81-2 is the registry number for Methyl N-(5-(chlorosulfonyl)-4-methyl-1,3-thiazol-2-yl)carbamate, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Methyl N-(5-chlorosulfonyl-4-methyl-1,3-thiazol-2-yl)carbamate (CAS 1602614-81-2) is a chemical compound with the molecular formula C6H7ClN2O4S2 and a molecular weight of 270.7 g/mol. IUPAC name: methyl N-(5-chlorosulfonyl-4-methyl-1,3-thiazol-2-yl)carbamate. InChIKey: FFVKKVLKBSOQLV-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O4S2 |
|---|---|
| Molecular weight | 270.7 g/mol |
| IUPAC name | methyl N-(5-chlorosulfonyl-4-methyl-1,3-thiazol-2-yl)carbamate |
| InChIKey | FFVKKVLKBSOQLV-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)NC(=O)OC)S(=O)(=O)Cl |
Computed by PubChem (NCBI)