CAS 1602704-82-4 appears in our catalog under these names: 2,3-Dihydro-1-benzoxepine-4-sulfonyl chloride, 2,3-Dihydro-1-benzoxepine-4-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
2,3-dihydro-1-benzoxepine-4-sulfonyl chloride (CAS 1602704-82-4) is a chemical compound with the molecular formula C10H9ClO3S and a molecular weight of 244.69 g/mol. IUPAC name: 2,3-dihydro-1-benzoxepine-4-sulfonyl chloride. InChIKey: SIQCEPFBSLNZHE-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO3S |
|---|---|
| Molecular weight | 244.69 g/mol |
| IUPAC name | 2,3-dihydro-1-benzoxepine-4-sulfonyl chloride |
| InChIKey | SIQCEPFBSLNZHE-UHFFFAOYSA-N |
| SMILES | C1COC2=CC=CC=C2C=C1S(=O)(=O)Cl |
Computed by PubChem (NCBI)