CAS 1602859-53-9 appears in our catalog under these names: 4-Chloro-7-fluoro-3-iodo-6-methoxyquinoline, 95%, 4-Chloro-7-fluoro-3-iodo-6-methoxyquinoline, 97%, 4–Chloro–7–fluoro–3–iodo–6–methoxyquinoline, 4-chloro-7-fluoro-3-iodo-6-methoxyquinoline. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 5g, 1g, 2,5g.
4-chloro-7-fluoro-3-iodo-6-methoxyquinoline (CAS 1602859-53-9) is a chemical compound with the molecular formula C10H6ClFINO and a molecular weight of 337.51 g/mol. IUPAC name: 4-chloro-7-fluoro-3-iodo-6-methoxyquinoline. InChIKey: JOLRWGDFPFFFJG-UHFFFAOYSA-N.
| Molecular formula | C10H6ClFINO |
|---|---|
| Molecular weight | 337.51 g/mol |
| IUPAC name | 4-chloro-7-fluoro-3-iodo-6-methoxyquinoline |
| InChIKey | JOLRWGDFPFFFJG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=C(C=N2)I)Cl)F |
Computed by PubChem (NCBI)