Products 1603-55-0
CAS 1603-55-0 appears in our catalog under these names: Cyclohexene-d10, >95% (GC), Cyclohexene-d10, 98 atom % D, min 98% Chemical Purity, Cyclohexene–d10, CYCLOHEXENE-D10, 98 ATOM % D. Offered by: TRC, CDN, GLPBio, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 250mg, 0,5g, 5g.
1,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexene (CAS 1603-55-0) is a chemical compound with the molecular formula C6H10 and a molecular weight of 92.20 g/mol. IUPAC name: 1,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexene. InChIKey: HGCIXCUEYOPUTN-KYJNQUCMSA-N.
| Molecular formula | C6H10 |
|---|---|
| Molecular weight | 92.20 g/mol |
| IUPAC name | 1,2,3,3,4,4,5,5,6,6-decadeuteriocyclohexene |
| InChIKey | HGCIXCUEYOPUTN-KYJNQUCMSA-N |
| SMILES | [2H]C1=C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)