CAS 1603173-59-6 appears in our catalog under these names: tert-Butyl 4-(chlorosulfonyl)-1,4-diazepane-1-carboxylate, 95%, tert-Butyl 4-(chlorosulfonyl)-1,4-diazepane-1-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl 4-chlorosulfonyl-1,4-diazepane-1-carboxylate (CAS 1603173-59-6) is a chemical compound with the molecular formula C10H19ClN2O4S and a molecular weight of 298.79 g/mol. IUPAC name: tert-butyl 4-chlorosulfonyl-1,4-diazepane-1-carboxylate. InChIKey: MLPZHYQMQBAWIF-UHFFFAOYSA-N.
| Molecular formula | C10H19ClN2O4S |
|---|---|
| Molecular weight | 298.79 g/mol |
| IUPAC name | tert-butyl 4-chlorosulfonyl-1,4-diazepane-1-carboxylate |
| InChIKey | MLPZHYQMQBAWIF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCN(CC1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)