CAS 1604264-78-9 appears in our catalog under these names: tert-Butyl N-((1R)-1-cyanopropyl)carbamate, 95%, tert-Butyl N-((1R)-1-cyanopropyl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Tert-butyl N-[(1R)-1-cyanopropyl]carbamate (CAS 1604264-78-9) is a chemical compound with the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. IUPAC name: tert-butyl N-[(1R)-1-cyanopropyl]carbamate. InChIKey: DJRSLDLTFGBKDH-SSDOTTSWSA-N.
| Molecular formula | C9H16N2O2 |
|---|---|
| Molecular weight | 184.24 g/mol |
| IUPAC name | tert-butyl N-[(1R)-1-cyanopropyl]carbamate |
| InChIKey | DJRSLDLTFGBKDH-SSDOTTSWSA-N |
| SMILES | CC[C@H](C#N)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)