CAS 160448-53-3 is the registry number for Isoleucylleucine TFA Salt. Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.
(2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-4-methylpentanoic acid;2,2,2-trifluoroacetic acid (CAS 160448-53-3) is a chemical compound with the molecular formula C14H25F3N2O5 and a molecular weight of 358.35 g/mol. IUPAC name: (2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-4-methylpentanoic acid;2,2,2-trifluoroacetic acid. InChIKey: HGOSTIDMEUANHK-PUBMXKGKSA-N.
| Molecular formula | C14H25F3N2O5 |
|---|---|
| Molecular weight | 358.35 g/mol |
| IUPAC name | (2S)-2-[[(2S,3S)-2-amino-3-methylpentanoyl]amino]-4-methylpentanoic acid;2,2,2-trifluoroacetic acid |
| InChIKey | HGOSTIDMEUANHK-PUBMXKGKSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)O)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)