CAS 16045-72-0 is the registry number for Creatinine zinc chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
Bis(2-amino-3-methyl-4H-imidazol-5-one);dichlorozinc (CAS 16045-72-0) is a chemical compound with the molecular formula C8H14Cl2N6O2Zn and a molecular weight of 362.5 g/mol. IUPAC name: bis(2-amino-3-methyl-4H-imidazol-5-one);dichlorozinc. InChIKey: SDBNHMFCQJHUNL-UHFFFAOYSA-L.
| Molecular formula | C8H14Cl2N6O2Zn |
|---|---|
| Molecular weight | 362.5 g/mol |
| IUPAC name | bis(2-amino-3-methyl-4H-imidazol-5-one);dichlorozinc |
| InChIKey | SDBNHMFCQJHUNL-UHFFFAOYSA-L |
| SMILES | CN1CC(=O)N=C1N.CN1CC(=O)N=C1N.Cl[Zn]Cl |
Computed by PubChem (NCBI)