CAS 160468-17-7 appears in our catalog under these names: (R)-3-Carboxy-2-hydroxy-N,N,N-trimethylpropan-1-aminium 2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylate, 97%, L-Carnitine Orotate, L–Carnitine Orotate, L-Carnitine orotate, 98%. Offered by: AmBeed, TRC, GLPBio, Chemat. Available pack sizes: 250mg, 100mg, 1g, 500mg.
3-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxy-4-(trimethylazaniumyl)butanoate (CAS 160468-17-7) is a chemical compound with the molecular formula C12H17N3O6 and a molecular weight of 299.28 g/mol. IUPAC name: 3-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxy-4-(trimethylazaniumyl)butanoate. InChIKey: VOTPLFCPIRIALF-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O6 |
|---|---|
| Molecular weight | 299.28 g/mol |
| IUPAC name | 3-(2,4-dioxo-1H-pyrimidine-6-carbonyl)oxy-4-(trimethylazaniumyl)butanoate |
| InChIKey | VOTPLFCPIRIALF-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CC(CC(=O)[O-])OC(=O)C1=CC(=O)NC(=O)N1 |
Computed by PubChem (NCBI)