Products 1604729-40-9
CAS 1604729-40-9 is the registry number for (4S)-2-(3,3-Dimethyloxiran-2-yl)-4-methyloxane. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(4S)-2-(3,3-dimethyloxiran-2-yl)-4-methyloxane (CAS 1604729-40-9) is a chemical compound with the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. IUPAC name: (4S)-2-(3,3-dimethyloxiran-2-yl)-4-methyloxane. InChIKey: WJXPSIYAXOVSRJ-UEJVZZJDSA-N.
| Molecular formula | C10H18O2 |
|---|---|
| Molecular weight | 170.25 g/mol |
| IUPAC name | (4S)-2-(3,3-dimethyloxiran-2-yl)-4-methyloxane |
| InChIKey | WJXPSIYAXOVSRJ-UEJVZZJDSA-N |
| SMILES | C[C@H]1CCOC(C1)C2C(O2)(C)C |
Computed by PubChem (NCBI)