CAS 160481-43-6 appears in our catalog under these names: (Iodoethynyl)triisopropylsilane 97%, (Iodoethynyl)triisopropylsilane, 97%, 97%, (Iodoethynyl)triisopropylsilane, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.
2-iodoethynyl-tri(propan-2-yl)silane (CAS 160481-43-6) is a chemical compound with the molecular formula C11H21ISi and a molecular weight of 308.27 g/mol. IUPAC name: 2-iodoethynyl-tri(propan-2-yl)silane. InChIKey: BFUSARJAXABPTC-UHFFFAOYSA-N.
| Molecular formula | C11H21ISi |
|---|---|
| Molecular weight | 308.27 g/mol |
| IUPAC name | 2-iodoethynyl-tri(propan-2-yl)silane |
| InChIKey | BFUSARJAXABPTC-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C#CI)(C(C)C)C(C)C |
Computed by PubChem (NCBI)