CAS 160580-70-1 appears in our catalog under these names: Perfluorophenyl 3-(pyridin-2-yldisulfanyl)propanoate, 95%, PDP-Pfp, PDP–Pfp, PDP-Pfp 99%, PDP-Pfp, 98.27%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, MedChemExpress. Available pack sizes: 50mg, 2mg, 5mg, 10mg, 100mg, 500mg, 250mg, 1g.
(2,3,4,5,6-pentafluorophenyl) 3-(pyridin-2-yldisulfanyl)propanoate (CAS 160580-70-1) is a chemical compound with the molecular formula C14H8F5NO2S2 and a molecular weight of 381.3 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 3-(pyridin-2-yldisulfanyl)propanoate. InChIKey: ICRMTRFPJXTUCG-UHFFFAOYSA-N.
| Molecular formula | C14H8F5NO2S2 |
|---|---|
| Molecular weight | 381.3 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 3-(pyridin-2-yldisulfanyl)propanoate |
| InChIKey | ICRMTRFPJXTUCG-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)SSCCC(=O)OC2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)