Products 160591-91-3
CAS 160591-91-3 appears in our catalog under these names: 4–Chloro–2–fluorobenzeneboronic acid, 4-Chloro-2-fluorobenzeneboronic acid, 97% , 4-Chloro-2-fluorophenylboronic Acid (contains varying amounts of Anhydride), 4-Chloro-2-fluorobenzeneboronic acid 97%, 4-Chloro-2-fluorophenylboronic acid, 97%, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 25g, 10g, 1g, 5g, 250mg, 100g, 500g, 1000g.
(4-chloro-2-fluorophenyl)boronic acid (CAS 160591-91-3) is a chemical compound with the molecular formula C6H5BClFO2 and a molecular weight of 174.37 g/mol. IUPAC name: (4-chloro-2-fluorophenyl)boronic acid. InChIKey: YBNDRTRLXPEWKQ-UHFFFAOYSA-N.
| Molecular formula | C6H5BClFO2 |
|---|---|
| Molecular weight | 174.37 g/mol |
| IUPAC name | (4-chloro-2-fluorophenyl)boronic acid |
| InChIKey | YBNDRTRLXPEWKQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Cl)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-chloro-2-fluorophenyl)boronic acid, 4-Chloro-2-fluorophenylboronic acid, 4-Chloro-2-fluorobenzeneboronic acid, 4-Chloro-2-Fluorophenyl-Boronic Acid, 4-chloro-2-fluoro-phenylboronic acid, 4-chloro-2-fluorophenyl boronic acid, 4-chloro-2-fluorobenzene boronic acid, 4-chloro-2-fluorophenylboronic acid (contains varying amounts of anhydride), (4-chloro-2-fluoro-phenyl)boronic Acid, Boronic acid, (4-chloro-2-fluorophenyl)-