CAS 16063-84-6 appears in our catalog under these names: 4-Biphenylyl Sulfate Potassium Salt, >95% (HPLC), 4-Hydroxybiphenyl-O-sulfate potassium. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 500mg, 50mg, 10mg.
Potassium (4-phenylphenyl) sulfate (CAS 16063-84-6) is a chemical compound with the molecular formula C12H9KO4S and a molecular weight of 288.36 g/mol. IUPAC name: potassium (4-phenylphenyl) sulfate. InChIKey: PULZWJPOJVBDEU-UHFFFAOYSA-M.
| Molecular formula | C12H9KO4S |
|---|---|
| Molecular weight | 288.36 g/mol |
| IUPAC name | potassium (4-phenylphenyl) sulfate |
| InChIKey | PULZWJPOJVBDEU-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)OS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)