Products 1606387-54-5
CAS 1606387-54-5 is the registry number for GmhA-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3S,4S)-5-[formyl(hydroxy)amino]-2,3,4-trihydroxypentyl] dihydrogen phosphate (CAS 1606387-54-5) is a chemical compound with the molecular formula C6H14NO9P and a molecular weight of 275.15 g/mol. IUPAC name: [(2R,3S,4S)-5-[formyl(hydroxy)amino]-2,3,4-trihydroxypentyl] dihydrogen phosphate. InChIKey: LBJFEFHCTYMJFD-JKUQZMGJSA-N.
| Molecular formula | C6H14NO9P |
|---|---|
| Molecular weight | 275.15 g/mol |
| IUPAC name | [(2R,3S,4S)-5-[formyl(hydroxy)amino]-2,3,4-trihydroxypentyl] dihydrogen phosphate |
| InChIKey | LBJFEFHCTYMJFD-JKUQZMGJSA-N |
| SMILES | C([C@@H]([C@@H]([C@@H](COP(=O)(O)O)O)O)O)N(C=O)O |
Computed by PubChem (NCBI)