CAS 160656-62-2 appears in our catalog under these names: S–(Trifluoromethyl)dibenzothiophenium–3–sulfonate, S-(Trifluoromethyl)dibenzothiophenium-3-sulfonate. Offered by: GLPBio, Fluorochem. Available pack sizes: 200mg.
5-(trifluoromethyl)dibenzothiophen-5-ium-3-sulfonate (CAS 160656-62-2) is a chemical compound with the molecular formula C13H7F3O3S2 and a molecular weight of 332.3 g/mol. IUPAC name: 5-(trifluoromethyl)dibenzothiophen-5-ium-3-sulfonate. InChIKey: MAAZDBJRZKJGIM-UHFFFAOYSA-N.
| Molecular formula | C13H7F3O3S2 |
|---|---|
| Molecular weight | 332.3 g/mol |
| IUPAC name | 5-(trifluoromethyl)dibenzothiophen-5-ium-3-sulfonate |
| InChIKey | MAAZDBJRZKJGIM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C([S+]2C(F)(F)F)C=C(C=C3)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)