CAS 160667-44-7 is the registry number for 1,2,4,6,7,9-Hexafluorodibenzo-p-dioxin. Offered by: TRC. Available pack sizes: 50mg.
1,2,4,6,7,9-hexafluorodibenzo-p-dioxin (CAS 160667-44-7) is a chemical compound with the molecular formula C12H2F6O2 and a molecular weight of 292.13 g/mol. IUPAC name: 1,2,4,6,7,9-hexafluorodibenzo-p-dioxin. InChIKey: FOADTOVERZWUIR-UHFFFAOYSA-N.
| Molecular formula | C12H2F6O2 |
|---|---|
| Molecular weight | 292.13 g/mol |
| IUPAC name | 1,2,4,6,7,9-hexafluorodibenzo-p-dioxin |
| InChIKey | FOADTOVERZWUIR-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C(=C1F)F)OC3=C(O2)C(=C(C=C3F)F)F)F |
Computed by PubChem (NCBI)