Products 16067-99-5

CAS 16067-99-5 is the registry number for 1 3-BIS(TRIETHOXYSILYL)BENZENE 96, 98%,RG, 98%,RG. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

Triethoxy-(3-triethoxysilylphenyl)silane (CAS 16067-99-5) is a chemical compound with the molecular formula C18H34O6Si2 and a molecular weight of 402.6 g/mol. IUPAC name: triethoxy-(3-triethoxysilylphenyl)silane. InChIKey: MRBRVZDGOJHHFZ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H34O6Si2
Molecular weight402.6 g/mol
IUPAC nametriethoxy-(3-triethoxysilylphenyl)silane
InChIKeyMRBRVZDGOJHHFZ-UHFFFAOYSA-N
SMILESCCO[Si](C1=CC(=CC=C1)[Si](OCC)(OCC)OCC)(OCC)OCC

Computed by PubChem (NCBI)