Products 16069-23-1

CAS 16069-23-1 is the registry number for Diphenyl 2-(methacryloyloxy)-ethyl phosphate. Offered by: Biosynth. Available pack sizes: 50g.

Structural formula: {0} (CAS {1})

2-diphenoxyphosphoryloxyethyl 2-methylprop-2-enoate (CAS 16069-23-1) is a chemical compound with the molecular formula C18H19O6P and a molecular weight of 362.3 g/mol. IUPAC name: 2-diphenoxyphosphoryloxyethyl 2-methylprop-2-enoate. InChIKey: VPCUASPSUAEJFE-UHFFFAOYSA-N.

Identity
Molecular formulaC18H19O6P
Molecular weight362.3 g/mol
IUPAC name2-diphenoxyphosphoryloxyethyl 2-methylprop-2-enoate
InChIKeyVPCUASPSUAEJFE-UHFFFAOYSA-N
SMILESCC(=C)C(=O)OCCOP(=O)(OC1=CC=CC=C1)OC2=CC=CC=C2

Computed by PubChem (NCBI)