CAS 1606995-47-4 is the registry number for Itareparib. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(1-cyclohexylpiperidin-4-yl)-6-fluoro-3-oxo-1H-isoindole-4-carboxamide (CAS 1606995-47-4) is a chemical compound with the molecular formula C20H26FN3O2 and a molecular weight of 359.4 g/mol. IUPAC name: 2-(1-cyclohexylpiperidin-4-yl)-6-fluoro-3-oxo-1H-isoindole-4-carboxamide. InChIKey: FKYQTFXJWMLOJE-UHFFFAOYSA-N.
| Molecular formula | C20H26FN3O2 |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 2-(1-cyclohexylpiperidin-4-yl)-6-fluoro-3-oxo-1H-isoindole-4-carboxamide |
| InChIKey | FKYQTFXJWMLOJE-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N2CCC(CC2)N3CC4=C(C3=O)C(=CC(=C4)F)C(=O)N |
Computed by PubChem (NCBI)