CAS 1607796-83-7 appears in our catalog under these names: Levofloxacin Impurity 7, Levofloxacin Impurity 23, Levofloxacin Impurity 18. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2S)-6-ethoxy-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid (CAS 1607796-83-7) is a chemical compound with the molecular formula C15H14FNO5 and a molecular weight of 307.27 g/mol. IUPAC name: (2S)-6-ethoxy-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid. InChIKey: ZLVJJPLJAOXSJS-ZETCQYMHSA-N.
| Molecular formula | C15H14FNO5 |
|---|---|
| Molecular weight | 307.27 g/mol |
| IUPAC name | (2S)-6-ethoxy-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
| InChIKey | ZLVJJPLJAOXSJS-ZETCQYMHSA-N |
| SMILES | CCOC1=C(C=C2C3=C1OC[C@@H](N3C=C(C2=O)C(=O)O)C)F |
Computed by PubChem (NCBI)