CAS 2410658-30-7 is the registry number for 1-Cyclopropyl-7-fluoro-6,8-dimethoxy-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-cyclopropyl-7-fluoro-6,8-dimethoxy-4-oxoquinoline-3-carboxylic acid (CAS 2410658-30-7) is a chemical compound with the molecular formula C15H14FNO5 and a molecular weight of 307.27 g/mol. IUPAC name: 1-cyclopropyl-7-fluoro-6,8-dimethoxy-4-oxoquinoline-3-carboxylic acid. InChIKey: MPLUEQWAYCRQFT-UHFFFAOYSA-N.
| Molecular formula | C15H14FNO5 |
|---|---|
| Molecular weight | 307.27 g/mol |
| IUPAC name | 1-cyclopropyl-7-fluoro-6,8-dimethoxy-4-oxoquinoline-3-carboxylic acid |
| InChIKey | MPLUEQWAYCRQFT-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1)C(=O)C(=CN2C3CC3)C(=O)O)OC)F |
Computed by PubChem (NCBI)