CAS 1608089-22-0 is the registry number for Pteroic Acid NHS Ester. Offered by: TRC. Available pack sizes: 100mg.
(2,5-dioxopyrrolidin-1-yl) 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoate (CAS 1608089-22-0) is a chemical compound with the molecular formula C18H15N7O5 and a molecular weight of 409.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoate. InChIKey: NMIVTDMJQNIWAK-UHFFFAOYSA-N.
| Molecular formula | C18H15N7O5 |
|---|---|
| Molecular weight | 409.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoate |
| InChIKey | NMIVTDMJQNIWAK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=CC=C(C=C2)NCC3=CN=C4C(=N3)C(=O)NC(=N4)N |
Computed by PubChem (NCBI)